C12H9BrO3 — CID 150681279
2-(4-bromophenyl)-3-hydroxy-6-methylpyran-4-one (PubChem CID 150681279) has the molecular formula C12H9BrO3 and a molecular weight of 281.11 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-hydroxy-6-methylpyran-4-one.
| Compound Name | 2-(4-bromophenyl)-3-hydroxy-6-methylpyran-4-one |
|---|---|
| PubChem CID | 150681279 |
| Molecular Formula | C12H9BrO3 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 2-(4-bromophenyl)-3-hydroxy-6-methylpyran-4-one |
| SMILES | Cc1cc(=O)c(O)c(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C12H9BrO3/c1-7-6-10(14)11(15)12(16-7)8-2-4-9(13)5-3-8/h2-6,15H,1H3 |
| InChIKey | JHXRZLVGFICDAY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |