C14H7BrClNO3 — CID 129139347
2-(4-bromophenyl)-5-chloro-3-hydroxypyrano[2,3-c]pyridin-4-one (PubChem CID 129139347) has the molecular formula C14H7BrClNO3 and a molecular weight of 352.57 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-chloro-3-hydroxypyrano[2,3-c]pyridin-4-one.
| Compound Name | 2-(4-bromophenyl)-5-chloro-3-hydroxypyrano[2,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 129139347 |
| Molecular Formula | C14H7BrClNO3 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2-(4-bromophenyl)-5-chloro-3-hydroxypyrano[2,3-c]pyridin-4-one |
| SMILES | O=c1c(O)c(-c2ccc(Br)cc2)oc2cncc(Cl)c12 |
| InChI | InChI=1S/C14H7BrClNO3/c15-8-3-1-7(2-4-8)14-13(19)12(18)11-9(16)5-17-6-10(11)20-14/h1-6,19H |
| InChIKey | RCTGZIXIWCMALJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |