C8H5F9O2 — CID 150689805
2-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxymethyl)oxirane (PubChem CID 150689805) has the molecular formula C8H5F9O2 and a molecular weight of 304.11 g/mol. Its IUPAC name is 2-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxymethyl)oxirane.
| Compound Name | 2-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxymethyl)oxirane |
|---|---|
| PubChem CID | 150689805 |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxymethyl)oxirane |
| SMILES | FC(OCC1CO1)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9O2/c9-4(5(10)19-2-3-1-18-3)6(11,12)7(13,14)8(15,16)17/h3H,1-2H2 |
| InChIKey | JJQGUQJWJNTELY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|