C6H5F5O2 — CID 58612478
2-[[(E)-1,2,3,3,3-pentafluoroprop-1-enoxy]methyl]oxirane (PubChem CID 58612478) has the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. Its IUPAC name is 2-[[(E)-1,2,3,3,3-pentafluoroprop-1-enoxy]methyl]oxirane.
| Compound Name | 2-[[(E)-1,2,3,3,3-pentafluoroprop-1-enoxy]methyl]oxirane |
|---|---|
| PubChem CID | 58612478 |
| Molecular Formula | C6H5F5O2 |
| Molecular Weight | 204.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-[[(E)-1,2,3,3,3-pentafluoroprop-1-enoxy]methyl]oxirane |
| SMILES | F/C(OCC1CO1)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C6H5F5O2/c7-4(6(9,10)11)5(8)13-2-3-1-12-3/h3H,1-2H2/b5-4- |
| InChIKey | NFNPBNYFCBHSPI-PLNGDYQASA-N |
| XLogP | 2.07 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|