About 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane
2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane (PubChem CID 58612477) has the molecular formula C6H8F2O2
and a molecular weight of 150.12 g/mol. Its IUPAC name is 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane |
| PubChem CID | 58612477 |
| Molecular Formula | C6H8F2O2 |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane |
| SMILES | C/C(F)=C(\F)OCC1CO1 |
| InChI | InChI=1S/C6H8F2O2/c1-4(7)6(8)10-3-5-2-9-5/h5H,2-3H2,1H3/b6-4- |
| InChIKey | AWJSKYKIBFNSKM-XQRVVYSFSA-N |
| XLogP | 1.53 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane?
The IUPAC name of 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane (CID 58612477) is 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane.
What is the SMILES notation for 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane?
The canonical SMILES for 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane is C/C(F)=C(\F)OCC1CO1.
What is the InChIKey of 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane?
The InChIKey is AWJSKYKIBFNSKM-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H8F2O2/c1-4(7)6(8)10-3-5-2-9-5/h5H,2-3H2,1H3/b6-4-.
What are the key properties of 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane?
2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane has a molecular weight of 150.12 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-1,2-difluoroprop-1-enoxy]methyl]oxirane is sourced from PubChem (CID 58612477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).