C6H7F3O2 — CID 58858724
2-(1,1,3-trifluoroprop-1-en-2-yloxymethyl)oxirane (PubChem CID 58858724) has the molecular formula C6H7F3O2 and a molecular weight of 168.11 g/mol. Its IUPAC name is 2-(1,1,3-trifluoroprop-1-en-2-yloxymethyl)oxirane.
| Compound Name | 2-(1,1,3-trifluoroprop-1-en-2-yloxymethyl)oxirane |
|---|---|
| PubChem CID | 58858724 |
| Molecular Formula | C6H7F3O2 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-(1,1,3-trifluoroprop-1-en-2-yloxymethyl)oxirane |
| SMILES | FCC(OCC1CO1)=C(F)F |
| InChI | InChI=1S/C6H7F3O2/c7-1-5(6(8)9)11-3-4-2-10-4/h4H,1-3H2 |
| InChIKey | QPZNBMHTYLGUPU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|