C17H17F3N2O — CID 150696154
(1S,3R,4S)-3-[4-[5-(trifluoromethyl)-2H-pyridin-1-yl]phenyl]-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 150696154) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is (1S,3R,4S)-3-[4-[5-(trifluoromethyl)-2H-pyridin-1-yl]phenyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | (1S,3R,4S)-3-[4-[5-(trifluoromethyl)-2H-pyridin-1-yl]phenyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 150696154 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (1S,3R,4S)-3-[4-[5-(trifluoromethyl)-2H-pyridin-1-yl]phenyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | FC(F)(F)C1=CN(c2ccc([C@H]3O[C@@H]4CN[C@H]3C4)cc2)CC=C1 |
| InChI | InChI=1S/C17H17F3N2O/c18-17(19,20)12-2-1-7-22(10-12)13-5-3-11(4-6-13)16-15-8-14(23-16)9-21-15/h1-6,10,14-16,21H,7-9H2/t14-,15-,16+/m0/s1 |
| InChIKey | JKWSVQGXVJWMLX-HRCADAONSA-N |
| XLogP | 3.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|