C18H22ClN3O3 — CID 158108821
ethyl (E)-3-amino-2-chloro-5-[4-[(1S,3R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]phenyl]-4-oxopent-2-enimidate (PubChem CID 158108821) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-chloro-5-[4-[(1S,3R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]phenyl]-4-oxopent-2-enimidate.
| Compound Name | ethyl (E)-3-amino-2-chloro-5-[4-[(1S,3R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]phenyl]-4-oxopent-2-enimidate |
|---|---|
| PubChem CID | 158108821 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl (E)-3-amino-2-chloro-5-[4-[(1S,3R,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]phenyl]-4-oxopent-2-enimidate |
| SMILES | [H]/N=C(OCC)/C(Cl)=C(\N)C(=O)Cc1ccc([C@H]2O[C@@H]3CN[C@H]2C3)cc1 |
| InChI | InChI=1S/C18H22ClN3O3/c1-2-24-18(21)15(19)16(20)14(23)7-10-3-5-11(6-4-10)17-13-8-12(25-17)9-22-13/h3-6,12-13,17,21-22H,2,7-9,20H2,1H3/b16-15+,21-18-/t12-,13-,17+/m0/s1 |
| InChIKey | FQEANEVQGLBMDG-SDXVRCKXSA-N |
| XLogP | 2.02 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|