About 1,2,3,6-tetrahydropyridin-3-yl acetate
1,2,3,6-tetrahydropyridin-3-yl acetate (PubChem CID 150697224) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridin-3-yl acetate.
Molecular Properties
| Compound Name | 1,2,3,6-tetrahydropyridin-3-yl acetate |
| PubChem CID | 150697224 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1,2,3,6-tetrahydropyridin-3-yl acetate |
| SMILES | CC(=O)OC1C=CCNC1 |
| InChI | InChI=1S/C7H11NO2/c1-6(9)10-7-3-2-4-8-5-7/h2-3,7-8H,4-5H2,1H3 |
| InChIKey | JLCFWBPBXKDDTI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,6-tetrahydropyridin-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,6-tetrahydropyridin-3-yl acetate?
The IUPAC name of 1,2,3,6-tetrahydropyridin-3-yl acetate (CID 150697224) is 1,2,3,6-tetrahydropyridin-3-yl acetate.
What is the SMILES notation for 1,2,3,6-tetrahydropyridin-3-yl acetate?
The canonical SMILES for 1,2,3,6-tetrahydropyridin-3-yl acetate is CC(=O)OC1C=CCNC1.
What is the InChIKey of 1,2,3,6-tetrahydropyridin-3-yl acetate?
The InChIKey is JLCFWBPBXKDDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-6(9)10-7-3-2-4-8-5-7/h2-3,7-8H,4-5H2,1H3.
What are the key properties of 1,2,3,6-tetrahydropyridin-3-yl acetate?
1,2,3,6-tetrahydropyridin-3-yl acetate has a molecular weight of 141.17 g/mol, XLogP of 0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,6-tetrahydropyridin-3-yl acetate is sourced from PubChem (CID 150697224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).