C18H39N3 — CID 150701001
1-N,1-N,1-N',1-N',2-N,2-N-hexamethyldodec-1-ene-1,1,2-triamine (PubChem CID 150701001) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N-hexamethyldodec-1-ene-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexamethyldodec-1-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 150701001 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexamethyldodec-1-ene-1,1,2-triamine |
| SMILES | CCCCCCCCCCC(=C(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C18H39N3/c1-8-9-10-11-12-13-14-15-16-17(19(2)3)18(20(4)5)21(6)7/h8-16H2,1-7H3 |
| InChIKey | JLWKOJOZESZUGE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|