C23H49N3 — CID 150751805
1-N,1-N,1-N',1-N',2-N,2-N-hexaethylundec-1-ene-1,1,2-triamine (PubChem CID 150751805) has the molecular formula C23H49N3 and a molecular weight of 367.67 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N-hexaethylundec-1-ene-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexaethylundec-1-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 150751805 |
| Molecular Formula | C23H49N3 |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 367.39 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexaethylundec-1-ene-1,1,2-triamine |
| SMILES | CCCCCCCCCC(=C(N(CC)CC)N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C23H49N3/c1-8-15-16-17-18-19-20-21-22(24(9-2)10-3)23(25(11-4)12-5)26(13-6)14-7/h8-21H2,1-7H3 |
| InChIKey | JWAHIOCIGZGWAS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|