C20H40N2 — CID 91543512
1,4,5-trimethyl-3-tetradecyl-2H-imidazole (PubChem CID 91543512) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 1,4,5-trimethyl-3-tetradecyl-2H-imidazole.
| Compound Name | 1,4,5-trimethyl-3-tetradecyl-2H-imidazole |
|---|---|
| PubChem CID | 91543512 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 1,4,5-trimethyl-3-tetradecyl-2H-imidazole |
| SMILES | CCCCCCCCCCCCCCN1CN(C)C(C)=C1C |
| InChI | InChI=1S/C20H40N2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-22-18-21(4)19(2)20(22)3/h5-18H2,1-4H3 |
| InChIKey | VKNUPVQRFUBPFC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|