C18H36N2 — CID 68897565
1-dodecyl-3,4,5-trimethyl-2H-imidazole (PubChem CID 68897565) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 1-dodecyl-3,4,5-trimethyl-2H-imidazole.
| Compound Name | 1-dodecyl-3,4,5-trimethyl-2H-imidazole |
|---|---|
| PubChem CID | 68897565 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 1-dodecyl-3,4,5-trimethyl-2H-imidazole |
| SMILES | CCCCCCCCCCCCN1CN(C)C(C)=C1C |
| InChI | InChI=1S/C18H36N2/c1-5-6-7-8-9-10-11-12-13-14-15-20-16-19(4)17(2)18(20)3/h5-16H2,1-4H3 |
| InChIKey | YTHRCQOLTQKKHQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|