C14H18O4 — CID 150722466
methyl 2-oxo-3a,4,5,6,7,8,9,9b-octahydro-3H-azuleno[1,2-b]furan-3-carboxylate (PubChem CID 150722466) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl 2-oxo-3a,4,5,6,7,8,9,9b-octahydro-3H-azuleno[1,2-b]furan-3-carboxylate.
| Compound Name | methyl 2-oxo-3a,4,5,6,7,8,9,9b-octahydro-3H-azuleno[1,2-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 150722466 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | methyl 2-oxo-3a,4,5,6,7,8,9,9b-octahydro-3H-azuleno[1,2-b]furan-3-carboxylate |
| SMILES | COC(=O)C1C(=O)OC2C3=C(CCCCC3)CC21 |
| InChI | InChI=1S/C14H18O4/c1-17-13(15)11-10-7-8-5-3-2-4-6-9(8)12(10)18-14(11)16/h10-12H,2-7H2,1H3 |
| InChIKey | JQDLQULRTALCIF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|