C19H21N3O3S — CID 150743197
[6-(5-tert-butyl-2-methylphenyl)sulfinyl-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 150743197) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is [6-(5-tert-butyl-2-methylphenyl)sulfinyl-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | [6-(5-tert-butyl-2-methylphenyl)sulfinyl-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 150743197 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [6-(5-tert-butyl-2-methylphenyl)sulfinyl-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)c1ccc2nc(NC(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-11-5-6-12(19(2,3)4)9-16(11)26(25)13-7-8-14-15(10-13)21-17(20-14)22-18(23)24/h5-10H,1-4H3,(H,23,24)(H2,20,21,22) |
| InChIKey | JUHGTMVVRGYLPU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |