C15H19N3O3S — CID 21318008
[6-[(E)-hept-4-enyl]sulfinyl-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 21318008) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is [6-[(E)-hept-4-enyl]sulfinyl-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | [6-[(E)-hept-4-enyl]sulfinyl-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 21318008 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [6-[(E)-hept-4-enyl]sulfinyl-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | CC/C=C/CCCS(=O)c1ccc2nc(NC(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-3-4-5-6-9-22(21)11-7-8-12-13(10-11)17-14(16-12)18-15(19)20/h3-4,7-8,10H,2,5-6,9H2,1H3,(H,19,20)(H2,16,17,18)/b4-3+ |
| InChIKey | LFTFSXZAICZMQR-ONEGZZNKSA-N |
| XLogP | 3.51 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|