C12H13N3O3S — CID 70609822
(6-but-2-enylsulfinyl-1H-benzimidazol-2-yl) carbamate (PubChem CID 70609822) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is (6-but-2-enylsulfinyl-1H-benzimidazol-2-yl) carbamate.
| Compound Name | (6-but-2-enylsulfinyl-1H-benzimidazol-2-yl) carbamate |
|---|---|
| PubChem CID | 70609822 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (6-but-2-enylsulfinyl-1H-benzimidazol-2-yl) carbamate |
| SMILES | CC=CCS(=O)c1ccc2nc(OC(N)=O)[nH]c2c1 |
| InChI | InChI=1S/C12H13N3O3S/c1-2-3-6-19(17)8-4-5-9-10(7-8)15-12(14-9)18-11(13)16/h2-5,7H,6H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | HVQAOYSDHNGUGU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|