C11H9Cl2N3O2 — CID 54358908
[6-(1,2-dichloroethenyl)-1H-benzimidazol-2-yl] N-methylcarbamate (PubChem CID 54358908) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is [6-(1,2-dichloroethenyl)-1H-benzimidazol-2-yl] N-methylcarbamate.
| Compound Name | [6-(1,2-dichloroethenyl)-1H-benzimidazol-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 54358908 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | [6-(1,2-dichloroethenyl)-1H-benzimidazol-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1nc2ccc(C(Cl)=CCl)cc2[nH]1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-14-11(17)18-10-15-8-3-2-6(7(13)5-12)4-9(8)16-10/h2-5H,1H3,(H,14,17)(H,15,16) |
| InChIKey | ULBREAZTSYCGBM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |