C18H24O4 — CID 15074638
4-hex-2-ynoxy-4-hex-1-ynyl-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 15074638) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-hex-2-ynoxy-4-hex-1-ynyl-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-hex-2-ynoxy-4-hex-1-ynyl-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15074638 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-hex-2-ynoxy-4-hex-1-ynyl-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | CCCC#CCOC1(C#CCCCC)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C18H24O4/c1-5-7-9-11-13-18(22-14-12-10-8-6-2)16(19)15(20-3)17(18)21-4/h5-9,14H2,1-4H3 |
| InChIKey | WODHVHSENIHKJX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|