C16H13NO3 — CID 15075340
(3-methyl-5-phenyl-1,2,4-dioxazol-3-yl)-phenylmethanone (PubChem CID 15075340) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is (3-methyl-5-phenyl-1,2,4-dioxazol-3-yl)-phenylmethanone.
| Compound Name | (3-methyl-5-phenyl-1,2,4-dioxazol-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 15075340 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (3-methyl-5-phenyl-1,2,4-dioxazol-3-yl)-phenylmethanone |
| SMILES | CC1(C(=O)c2ccccc2)N=C(c2ccccc2)OO1 |
| InChI | InChI=1S/C16H13NO3/c1-16(14(18)12-8-4-2-5-9-12)17-15(19-20-16)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | OUGRORDRYVOEDH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|