C15H11NO3 — CID 15075341
phenyl-(5-phenyl-3H-1,2,4-dioxazol-3-yl)methanone (PubChem CID 15075341) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is phenyl-(5-phenyl-3H-1,2,4-dioxazol-3-yl)methanone.
| Compound Name | phenyl-(5-phenyl-3H-1,2,4-dioxazol-3-yl)methanone |
|---|---|
| PubChem CID | 15075341 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | phenyl-(5-phenyl-3H-1,2,4-dioxazol-3-yl)methanone |
| SMILES | O=C(c1ccccc1)C1N=C(c2ccccc2)OO1 |
| InChI | InChI=1S/C15H11NO3/c17-13(11-7-3-1-4-8-11)15-16-14(18-19-15)12-9-5-2-6-10-12/h1-10,15H |
| InChIKey | BJFIGDZFACELND-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|