C32H68N2O — CID 150754771
N'-[4-(2-ethoxypropan-2-yl)-14,14-dimethyl-4-octylpentadecyl]ethane-1,2-diamine (PubChem CID 150754771) has the molecular formula C32H68N2O and a molecular weight of 496.91 g/mol. Its IUPAC name is N'-[4-(2-ethoxypropan-2-yl)-14,14-dimethyl-4-octylpentadecyl]ethane-1,2-diamine.
| Compound Name | N'-[4-(2-ethoxypropan-2-yl)-14,14-dimethyl-4-octylpentadecyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 150754771 |
| Molecular Formula | C32H68N2O |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.53 |
| IUPAC Name | N'-[4-(2-ethoxypropan-2-yl)-14,14-dimethyl-4-octylpentadecyl]ethane-1,2-diamine |
| SMILES | CCCCCCCCC(CCCCCCCCCC(C)(C)C)(CCCNCCN)C(C)(C)OCC |
| InChI | InChI=1S/C32H68N2O/c1-8-10-11-12-17-20-24-32(31(6,7)35-9-2,26-22-28-34-29-27-33)25-21-18-15-13-14-16-19-23-30(3,4)5/h34H,8-29,33H2,1-7H3 |
| InChIKey | JWPRRZCZUSETMV-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|