C11H6ClN3OS — CID 150757890
4-chloro-N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide (PubChem CID 150757890) has the molecular formula C11H6ClN3OS and a molecular weight of 263.71 g/mol. Its IUPAC name is 4-chloro-N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 150757890 |
| Molecular Formula | C11H6ClN3OS |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 4-chloro-N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1sncc1Cl |
| InChI | InChI=1S/C11H6ClN3OS/c12-8-6-14-17-10(8)11(16)15-9-4-2-1-3-7(9)5-13/h1-4,6H,(H,15,16) |
| InChIKey | JXFUNTNNSCCTED-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |