C11H7N3OS — CID 110692262
N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide (PubChem CID 110692262) has the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110692262 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1ccns1 |
| InChI | InChI=1S/C11H7N3OS/c12-7-8-3-1-2-4-9(8)14-11(15)10-5-6-13-16-10/h1-6H,(H,14,15) |
| InChIKey | UVGQPNNUWPVBPO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |