C11H16N4 — CID 150762634
N'-(3-methyl-2H-quinazolin-2-yl)ethane-1,2-diamine (PubChem CID 150762634) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N'-(3-methyl-2H-quinazolin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(3-methyl-2H-quinazolin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 150762634 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N'-(3-methyl-2H-quinazolin-2-yl)ethane-1,2-diamine |
| SMILES | CN1C=c2ccccc2=NC1NCCN |
| InChI | InChI=1S/C11H16N4/c1-15-8-9-4-2-3-5-10(9)14-11(15)13-7-6-12/h2-5,8,11,13H,6-7,12H2,1H3 |
| InChIKey | JYDOZOWJZDCMPN-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |