C10H22ClN — CID 150778945
2-chloro-N,N-diethyl-4-methylpentan-1-amine (PubChem CID 150778945) has the molecular formula C10H22ClN and a molecular weight of 191.75 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-methylpentan-1-amine.
| Compound Name | 2-chloro-N,N-diethyl-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 150778945 |
| Molecular Formula | C10H22ClN |
| Molecular Weight | 191.75 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-methylpentan-1-amine |
| SMILES | CCN(CC)CC(Cl)CC(C)C |
| InChI | InChI=1S/C10H22ClN/c1-5-12(6-2)8-10(11)7-9(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | KBLPACMXCCVYJO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|