C22H25ClN2O6S — CID 15078405
methyl 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoate (PubChem CID 15078405) has the molecular formula C22H25ClN2O6S and a molecular weight of 480.97 g/mol. Its IUPAC name is methyl 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 15078405 |
| Molecular Formula | C22H25ClN2O6S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)COc1ccc2c(c1)CC(NS(=O)(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C22H25ClN2O6S/c1-30-22(27)3-2-10-24-21(26)14-31-19-7-4-15-11-18(12-16(15)13-19)25-32(28,29)20-8-5-17(23)6-9-20/h4-9,13,18,25H,2-3,10-12,14H2,1H3,(H,24,26) |
| InChIKey | ZYSOMPUGSHWLQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|