C21H23ClN2O6S — CID 15078409
4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoic acid (PubChem CID 15078409) has the molecular formula C21H23ClN2O6S and a molecular weight of 466.94 g/mol. Its IUPAC name is 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 15078409 |
| Molecular Formula | C21H23ClN2O6S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]oxy]acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)COc1ccc2c(c1)CC(NS(=O)(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C21H23ClN2O6S/c22-16-4-7-19(8-5-16)31(28,29)24-17-10-14-3-6-18(12-15(14)11-17)30-13-20(25)23-9-1-2-21(26)27/h3-8,12,17,24H,1-2,9-11,13H2,(H,23,25)(H,26,27) |
| InChIKey | YQNJXQLRAZSVQR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|