C16H30O2 — CID 150796789
3-ethenyl-3,4-dimethoxydodec-1-ene (PubChem CID 150796789) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 3-ethenyl-3,4-dimethoxydodec-1-ene.
| Compound Name | 3-ethenyl-3,4-dimethoxydodec-1-ene |
|---|---|
| PubChem CID | 150796789 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 3-ethenyl-3,4-dimethoxydodec-1-ene |
| SMILES | C=CC(C=C)(OC)C(CCCCCCCC)OC |
| InChI | InChI=1S/C16H30O2/c1-6-9-10-11-12-13-14-15(17-4)16(7-2,8-3)18-5/h7-8,15H,2-3,6,9-14H2,1,4-5H3 |
| InChIKey | KFABFYZCRBAGLA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|