C15H11F2N3 — CID 15079732
7-fluoro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-amine (PubChem CID 15079732) has the molecular formula C15H11F2N3 and a molecular weight of 271.27 g/mol. Its IUPAC name is 7-fluoro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-amine.
| Compound Name | 7-fluoro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 15079732 |
| Molecular Formula | C15H11F2N3 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 7-fluoro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-amine |
| SMILES | NC1=Nc2ccc(F)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C15H11F2N3/c16-9-5-6-13-11(7-9)15(19-8-14(18)20-13)10-3-1-2-4-12(10)17/h1-7H,8H2,(H2,18,20) |
| InChIKey | OQCKQXATUQZTAE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |