C15H14N2 — CID 71682373
4-phenyl-3,4-dihydroquinolin-2-amine (PubChem CID 71682373) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-phenyl-3,4-dihydroquinolin-2-amine.
| Compound Name | 4-phenyl-3,4-dihydroquinolin-2-amine |
|---|---|
| PubChem CID | 71682373 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-phenyl-3,4-dihydroquinolin-2-amine |
| SMILES | NC1=Nc2ccccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H14N2/c16-15-10-13(11-6-2-1-3-7-11)12-8-4-5-9-14(12)17-15/h1-9,13H,10H2,(H2,16,17) |
| InChIKey | ZIEPGDHLBJIXNE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |