C21H21F4N5O5S — CID 150801446
ethyl 2-ethyl-5-[(2R)-2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 150801446) has the molecular formula C21H21F4N5O5S and a molecular weight of 531.49 g/mol. Its IUPAC name is ethyl 2-ethyl-5-[(2R)-2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 2-ethyl-5-[(2R)-2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 150801446 |
| Molecular Formula | C21H21F4N5O5S |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | ethyl 2-ethyl-5-[(2R)-2-[5-fluoro-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC)nn2ccc(N3CCC[C@@H]3c3cc(F)cnc3OS(=O)(=O)C(F)(F)F)nc12 |
| InChI | InChI=1S/C21H21F4N5O5S/c1-3-14-17(20(31)34-4-2)18-27-16(7-9-30(18)28-14)29-8-5-6-15(29)13-10-12(22)11-26-19(13)35-36(32,33)21(23,24)25/h7,9-11,15H,3-6,8H2,1-2H3/t15-/m1/s1 |
| InChIKey | KFYIEMGCSFOSNY-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 115.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|