C12H16F3N3O3 — CID 150802408
ethyl 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylate (PubChem CID 150802408) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is ethyl 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylate.
| Compound Name | ethyl 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 150802408 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl 2-[2-(2,2,2-trifluoroethylamino)ethyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxylate |
| SMILES | CCOC(=O)c1cc2n(n1)CC(CCNCC(F)(F)F)O2 |
| InChI | InChI=1S/C12H16F3N3O3/c1-2-20-11(19)9-5-10-18(17-9)6-8(21-10)3-4-16-7-12(13,14)15/h5,8,16H,2-4,6-7H2,1H3 |
| InChIKey | KGDMFHCPCZHXOZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|