C17H6Cl6 — CID 150804409
2,3,4,5,6,7-hexachloro-1-methylpyrene (PubChem CID 150804409) has the molecular formula C17H6Cl6 and a molecular weight of 422.95 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexachloro-1-methylpyrene.
| Compound Name | 2,3,4,5,6,7-hexachloro-1-methylpyrene |
|---|---|
| PubChem CID | 150804409 |
| Molecular Formula | C17H6Cl6 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 419.86 |
| IUPAC Name | 2,3,4,5,6,7-hexachloro-1-methylpyrene |
| SMILES | Cc1c(Cl)c(Cl)c2c(Cl)c(Cl)c3c(Cl)c(Cl)cc4ccc1c2c43 |
| InChI | InChI=1S/C17H6Cl6/c1-5-7-3-2-6-4-8(18)14(20)11-9(6)10(7)12(15(21)13(5)19)17(23)16(11)22/h2-4H,1H3 |
| InChIKey | KGOGZBJLYJPGKG-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|