C30H46O3P+ — CID 150824943
[2,3-bis(8-methoxyoctyl)phenyl]-oxo-phenylphosphanium (PubChem CID 150824943) has the molecular formula C30H46O3P+ and a molecular weight of 485.67 g/mol. Its IUPAC name is [2,3-bis(8-methoxyoctyl)phenyl]-oxo-phenylphosphanium.
| Compound Name | [2,3-bis(8-methoxyoctyl)phenyl]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 150824943 |
| Molecular Formula | C30H46O3P+ |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | [2,3-bis(8-methoxyoctyl)phenyl]-oxo-phenylphosphanium |
| SMILES | COCCCCCCCCc1cccc([P+](=O)c2ccccc2)c1CCCCCCCCOC |
| InChI | InChI=1S/C30H46O3P/c1-32-25-16-9-5-3-7-12-19-27-20-18-24-30(34(31)28-21-13-11-14-22-28)29(27)23-15-8-4-6-10-17-26-33-2/h11,13-14,18,20-22,24H,3-10,12,15-17,19,23,25-26H2,1-2H3/q+1 |
| InChIKey | IZOXZVUJRHXZHB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|