C16H26N4 — CID 150826942
N-methyl-N-nonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 150826942) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-methyl-N-nonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-N-nonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 150826942 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-methyl-N-nonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCCCCCN(C)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C16H26N4/c1-3-4-5-6-7-8-9-12-20(2)16-14-10-11-17-15(14)18-13-19-16/h10-11,13H,3-9,12H2,1-2H3,(H,17,18,19) |
| InChIKey | KLCVMXVLZMEWEB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|