C10H12N4O2 — CID 76849423
2-[ethyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]acetic acid (PubChem CID 76849423) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[ethyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[ethyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 76849423 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[ethyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]acetic acid |
| SMILES | CCN(CC(=O)O)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C10H12N4O2/c1-2-14(5-8(15)16)10-7-3-4-11-9(7)12-6-13-10/h3-4,6H,2,5H2,1H3,(H,15,16)(H,11,12,13) |
| InChIKey | OHQCMYPTRLFAEN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |