C12H16N4O2 — CID 122059153
4-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid (PubChem CID 122059153) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid.
| Compound Name | 4-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 122059153 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-methyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C12H16N4O2/c1-12(2,5-3-9(17)18)16-11-8-4-6-13-10(8)14-7-15-11/h4,6-7H,3,5H2,1-2H3,(H,17,18)(H2,13,14,15,16) |
| InChIKey | SVXSQTSZMRSTLD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |