C12H16N4O2 — CID 122049116
(2R)-4-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid (PubChem CID 122049116) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is (2R)-4-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid.
| Compound Name | (2R)-4-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 122049116 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (2R)-4-methyl-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)pentanoic acid |
| SMILES | CC(C)C[C@@H](Nc1ncnc2[nH]ccc12)C(=O)O |
| InChI | InChI=1S/C12H16N4O2/c1-7(2)5-9(12(17)18)16-11-8-3-4-13-10(8)14-6-15-11/h3-4,6-7,9H,5H2,1-2H3,(H,17,18)(H2,13,14,15,16)/t9-/m1/s1 |
| InChIKey | CKXSKOOFQJLASI-SECBINFHSA-N |
| XLogP | 1.87 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |