C11H15N5O3 — CID 22063219
4-methyl-2-[(8-oxo-7,9-dihydropurin-6-yl)amino]pentanoic acid (PubChem CID 22063219) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-methyl-2-[(8-oxo-7,9-dihydropurin-6-yl)amino]pentanoic acid.
| Compound Name | 4-methyl-2-[(8-oxo-7,9-dihydropurin-6-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 22063219 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-methyl-2-[(8-oxo-7,9-dihydropurin-6-yl)amino]pentanoic acid |
| SMILES | CC(C)CC(Nc1ncnc2[nH]c(=O)[nH]c12)C(=O)O |
| InChI | InChI=1S/C11H15N5O3/c1-5(2)3-6(10(17)18)14-8-7-9(13-4-12-8)16-11(19)15-7/h4-6H,3H2,1-2H3,(H,17,18)(H3,12,13,14,15,16,19) |
| InChIKey | URXGFZOAYNUVLY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |