C20H27N4+ — CID 15083181
2-(4-methyl-2-pyridinyl)-5-octyl-3H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 15083181) has the molecular formula C20H27N4+ and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-(4-methyl-2-pyridinyl)-5-octyl-3H-imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(4-methyl-2-pyridinyl)-5-octyl-3H-imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 15083181 |
| Molecular Formula | C20H27N4+ |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-(4-methyl-2-pyridinyl)-5-octyl-3H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | CCCCCCCC[n+]1ccc2nc(-c3cc(C)ccn3)[nH]c2c1 |
| InChI | InChI=1S/C20H26N4/c1-3-4-5-6-7-8-12-24-13-10-17-19(15-24)23-20(22-17)18-14-16(2)9-11-21-18/h9-11,13-15H,3-8,12H2,1-2H3/p+1 |
| InChIKey | VFIJUTXEJWSZJP-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|