C13H19FN2O — CID 150837589
(2S,3R)-2-(4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-amine (PubChem CID 150837589) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is (2S,3R)-2-(4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-amine.
| Compound Name | (2S,3R)-2-(4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 150837589 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (2S,3R)-2-(4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-amine |
| SMILES | COCCN1CC[C@@H](N)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN2O/c1-17-9-8-16-7-6-12(15)13(16)10-2-4-11(14)5-3-10/h2-5,12-13H,6-9,15H2,1H3/t12-,13+/m1/s1 |
| InChIKey | KNHSJTDGSFBZRD-OLZOCXBDSA-N |
| XLogP | 1.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |