C13H17ClFNO2 — CID 90759129
2-(2-chloro-4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-ol (PubChem CID 90759129) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-ol.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 90759129 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-ol |
| SMILES | COCCN1CCC(O)C1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H17ClFNO2/c1-18-7-6-16-5-4-12(17)13(16)10-3-2-9(15)8-11(10)14/h2-3,8,12-13,17H,4-7H2,1H3 |
| InChIKey | HHYRGMIWTRHLBH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |