C10H11ClFNO — CID 67175533
3-(2-chloro-4-fluorophenyl)-1-hydroxypyrrolidine (PubChem CID 67175533) has the molecular formula C10H11ClFNO and a molecular weight of 215.66 g/mol. Its IUPAC name is 3-(2-chloro-4-fluorophenyl)-1-hydroxypyrrolidine.
| Compound Name | 3-(2-chloro-4-fluorophenyl)-1-hydroxypyrrolidine |
|---|---|
| PubChem CID | 67175533 |
| Molecular Formula | C10H11ClFNO |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 3-(2-chloro-4-fluorophenyl)-1-hydroxypyrrolidine |
| SMILES | ON1CCC(c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C10H11ClFNO/c11-10-5-8(12)1-2-9(10)7-3-4-13(14)6-7/h1-2,5,7,14H,3-4,6H2 |
| InChIKey | JWEHWMGSBIMXGT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |