C12H12ClF3 — CID 177193132
2-chloro-1-(4,4-difluorocyclohexyl)-4-fluorobenzene (PubChem CID 177193132) has the molecular formula C12H12ClF3 and a molecular weight of 248.67 g/mol. Its IUPAC name is 2-chloro-1-(4,4-difluorocyclohexyl)-4-fluorobenzene.
| Compound Name | 2-chloro-1-(4,4-difluorocyclohexyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 177193132 |
| Molecular Formula | C12H12ClF3 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-chloro-1-(4,4-difluorocyclohexyl)-4-fluorobenzene |
| SMILES | Fc1ccc(C2CCC(F)(F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClF3/c13-11-7-9(14)1-2-10(11)8-3-5-12(15,16)6-4-8/h1-2,7-8H,3-6H2 |
| InChIKey | FIPCLYDUCMSUCF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |