C36H35F2N3O3 — CID 150840525
7-[[1-[4-(2,4-difluorophenyl)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-5-methyl-7H-carbazole-4-carboxamide (PubChem CID 150840525) has the molecular formula C36H35F2N3O3 and a molecular weight of 595.69 g/mol. Its IUPAC name is 7-[[1-[4-(2,4-difluorophenyl)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-5-methyl-7H-carbazole-4-carboxamide.
| Compound Name | 7-[[1-[4-(2,4-difluorophenyl)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-5-methyl-7H-carbazole-4-carboxamide |
|---|---|
| PubChem CID | 150840525 |
| Molecular Formula | C36H35F2N3O3 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 7-[[1-[4-(2,4-difluorophenyl)benzoyl]piperidin-4-yl]methyl]-N-(2-methoxyethyl)-5-methyl-7H-carbazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cccc2c1=C1C(C)=CC(CC3CCN(C(=O)c4ccc(-c5ccc(F)cc5F)cc4)CC3)C=C1N=2 |
| InChI | InChI=1S/C36H35F2N3O3/c1-22-18-24(20-32-33(22)34-29(4-3-5-31(34)40-32)35(42)39-14-17-44-2)19-23-12-15-41(16-13-23)36(43)26-8-6-25(7-9-26)28-11-10-27(37)21-30(28)38/h3-11,18,20-21,23-24H,12-17,19H2,1-2H3,(H,39,42) |
| InChIKey | KNWRSOCCOSDBHH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|