C43H49N3O3 — CID 150841794
butyl 2-[9H-fluoren-1-yl-(propan-2-ylamino)amino]-7-[9H-fluoren-1-yl(prop-2-enoyl)amino]heptanoate (PubChem CID 150841794) has the molecular formula C43H49N3O3 and a molecular weight of 655.88 g/mol. Its IUPAC name is butyl 2-[9H-fluoren-1-yl-(propan-2-ylamino)amino]-7-[9H-fluoren-1-yl(prop-2-enoyl)amino]heptanoate.
| Compound Name | butyl 2-[9H-fluoren-1-yl-(propan-2-ylamino)amino]-7-[9H-fluoren-1-yl(prop-2-enoyl)amino]heptanoate |
|---|---|
| PubChem CID | 150841794 |
| Molecular Formula | C43H49N3O3 |
| Molecular Weight | 655.88 g/mol |
| Exact Mass | 655.38 |
| IUPAC Name | butyl 2-[9H-fluoren-1-yl-(propan-2-ylamino)amino]-7-[9H-fluoren-1-yl(prop-2-enoyl)amino]heptanoate |
| SMILES | C=CC(=O)N(CCCCCC(C(=O)OCCCC)N(NC(C)C)c1cccc2c1Cc1ccccc1-2)c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C43H49N3O3/c1-5-7-27-49-43(48)41(46(44-30(3)4)40-25-16-22-36-34-20-13-11-18-32(34)29-38(36)40)23-9-8-14-26-45(42(47)6-2)39-24-15-21-35-33-19-12-10-17-31(33)28-37(35)39/h6,10-13,15-22,24-25,30,41,44H,2,5,7-9,14,23,26-29H2,1,3-4H3 |
| InChIKey | KODJCYSACDDJLH-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.88 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|