C31H46O4 — CID 161289439
1-prop-1-enyl-9H-fluorene;1,1,1-trimethoxy-2-(methoxymethyl)decane (PubChem CID 161289439) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 1-prop-1-enyl-9H-fluorene;1,1,1-trimethoxy-2-(methoxymethyl)decane.
| Compound Name | 1-prop-1-enyl-9H-fluorene;1,1,1-trimethoxy-2-(methoxymethyl)decane |
|---|---|
| PubChem CID | 161289439 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 1-prop-1-enyl-9H-fluorene;1,1,1-trimethoxy-2-(methoxymethyl)decane |
| SMILES | CC=Cc1cccc2c1Cc1ccccc1-2.CCCCCCCCC(COC)C(OC)(OC)OC |
| InChI | InChI=1S/C16H14.C15H32O4/c1-2-6-12-8-5-10-15-14-9-4-3-7-13(14)11-16(12)15;1-6-7-8-9-10-11-12-14(13-16-2)15(17-3,18-4)19-5/h2-10H,11H2,1H3;14H,6-13H2,1-5H3 |
| InChIKey | VGDQWXBNMKNQIZ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|