About 9H-fluorene-1-thiol;pentan-1-amine
9H-fluorene-1-thiol;pentan-1-amine (PubChem CID 175214866) has the molecular formula C18H23NS
and a molecular weight of 285.46 g/mol. Its IUPAC name is 9H-fluorene-1-thiol;pentan-1-amine.
Molecular Properties
| Compound Name | 9H-fluorene-1-thiol;pentan-1-amine |
| PubChem CID | 175214866 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 9H-fluorene-1-thiol;pentan-1-amine |
| SMILES | CCCCCN.Sc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10S.C5H13N/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-2-3-4-5-6/h1-7,14H,8H2;2-6H2,1H3 |
| InChIKey | HFQZUXRQQNROFX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene-1-thiol;pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene-1-thiol;pentan-1-amine?
The IUPAC name of 9H-fluorene-1-thiol;pentan-1-amine (CID 175214866) is 9H-fluorene-1-thiol;pentan-1-amine.
What is the SMILES notation for 9H-fluorene-1-thiol;pentan-1-amine?
The canonical SMILES for 9H-fluorene-1-thiol;pentan-1-amine is CCCCCN.Sc1cccc2c1Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene-1-thiol;pentan-1-amine?
The InChIKey is HFQZUXRQQNROFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S.C5H13N/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-2-3-4-5-6/h1-7,14H,8H2;2-6H2,1H3.
What are the key properties of 9H-fluorene-1-thiol;pentan-1-amine?
9H-fluorene-1-thiol;pentan-1-amine has a molecular weight of 285.46 g/mol, XLogP of 4.68, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene-1-thiol;pentan-1-amine is sourced from PubChem (CID 175214866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).