C10H20O4P2S3 — CID 15084262
2-[(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)sulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane (PubChem CID 15084262) has the molecular formula C10H20O4P2S3 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)sulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane.
| Compound Name | 2-[(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)sulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane |
|---|---|
| PubChem CID | 15084262 |
| Molecular Formula | C10H20O4P2S3 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2-[(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)sulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane |
| SMILES | CC1(C)COP(=S)(SP2(=S)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C10H20O4P2S3/c1-9(2)5-11-15(17,12-6-9)19-16(18)13-7-10(3,4)8-14-16/h5-8H2,1-4H3 |
| InChIKey | QJOBHAXUGXPRIU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|